EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O8 |
| Net Charge | 0 |
| Average Mass | 388.372 |
| Monoisotopic Mass | 388.11582 |
| SMILES | COc1cc(C(O)C(CO)Oc2cc3oc(=O)ccc3cc2OC)ccc1O |
| InChI | InChI=1S/C20H20O8/c1-25-15-8-12(3-5-13(15)22)20(24)18(10-21)27-17-9-14-11(7-16(17)26-2)4-6-19(23)28-14/h3-9,18,20-22,24H,10H2,1-2H3 |
| InChIKey | FVMVDYHTVNKQIF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| root (BTO:0001188) | PubMed (25457500) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guaiacylglycerol β-scopoletinyl ether (CHEBI:91201) has functional parent guaiacylglycerol (CHEBI:53663) |
| guaiacylglycerol β-scopoletinyl ether (CHEBI:91201) has functional parent scopoletin (CHEBI:17488) |
| guaiacylglycerol β-scopoletinyl ether (CHEBI:91201) has role plant metabolite (CHEBI:76924) |
| guaiacylglycerol β-scopoletinyl ether (CHEBI:91201) is a coumarins (CHEBI:23403) |
| guaiacylglycerol β-scopoletinyl ether (CHEBI:91201) is a guaiacyl lignin (CHEBI:64475) |
| guaiacylglycerol β-scopoletinyl ether (CHEBI:91201) is a primary alcohol (CHEBI:15734) |
| guaiacylglycerol β-scopoletinyl ether (CHEBI:91201) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 7-{[1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy}-6-methoxy-2H-1-benzopyran-2-one |
| Synonyms | Source |
|---|---|
| G(8-O-4)Scopoletin | ChEBI |
| 7-{[1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy}-6-methoxycoumarin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28063973 | Reaxys |