EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25NO4 |
| Net Charge | 0 |
| Average Mass | 295.379 |
| Monoisotopic Mass | 295.17836 |
| SMILES | [H][C@]12CC(=O)[C@]34CCCN3CCC[C@]14[C@@H](O)C[C@@](C)(O)[C@@H]2O |
| InChI | InChI=1S/C16H25NO4/c1-14(21)9-12(19)15-4-2-6-17-7-3-5-16(15,17)11(18)8-10(15)13(14)20/h10,12-13,19-21H,2-9H2,1H3/t10-,12+,13-,14-,15-,16+/m1/s1 |
| InChIKey | YCOAYVRPLHVBDP-YSHXYTTRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Serratanidine (CHEBI:9120) is a alkaloid (CHEBI:22315) |
| Serratanidine (CHEBI:9120) is a organic heterotetracyclic compound (CHEBI:38163) |
| Synonym | Source |
|---|---|
| Serratanidine | KEGG COMPOUND |