EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12N4 |
| Net Charge | 0 |
| Average Mass | 272.311 |
| Monoisotopic Mass | 272.10620 |
| SMILES | c1ccc(-c2nncc2-c2ccnc3ccccc23)nc1 |
| InChI | InChI=1S/C17H12N4/c1-2-6-15-13(5-1)12(8-10-19-15)14-11-20-21-17(14)16-7-3-4-9-18-16/h1-11H,(H,20,21) |
| InChIKey | IBCXZJCWDGCXQT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | TGFbeta receptor antagonist An antagonist that binds to and deactivates TGFβ receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY 364947 (CHEBI:91198) has role TGFβ receptor antagonist (CHEBI:91202) |
| LY 364947 (CHEBI:91198) is a pyrazoles (CHEBI:26410) |
| LY 364947 (CHEBI:91198) is a pyridines (CHEBI:26421) |
| LY 364947 (CHEBI:91198) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 4-[3-(pyridin-2-yl)-1H-pyrazol-4-yl]quinoline |
| Synonyms | Source |
|---|---|
| HTS 466284 | ChEBI |
| LY-364947 | ChEBI |
| LY364947 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9492522 | Reaxys |
| Citations |
|---|