EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23ClN2O5S |
| Net Charge | 0 |
| Average Mass | 474.966 |
| Monoisotopic Mass | 474.10162 |
| SMILES | Cc1noc(-c2ccc(CSCCC(=O)O)cc2)c1NC(=O)O[C@@H](C)c1ccccc1Cl |
| InChI | InChI=1S/C23H23ClN2O5S/c1-14-21(25-23(29)30-15(2)18-5-3-4-6-19(18)24)22(31-26-14)17-9-7-16(8-10-17)13-32-12-11-20(27)28/h3-10,15H,11-13H2,1-2H3,(H,25,29)(H,27,28)/t15-/m0/s1 |
| InChIKey | LLIFMNUXGDHTRO-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-KI16425 (CHEBI:91195) is a 3-[({4-[4-({[1-(2-chlorophenyl)ethoxy]carbonyl}amino)-3-methyl-1,2-oxazol-5-yl]phenyl}methyl)sulfanyl]propanoic acid (CHEBI:91194) |
| (S)-KI16425 (CHEBI:91195) is enantiomer of (R)-KI16425 (CHEBI:91197) |
| Incoming Relation(s) |
| KI16425 (CHEBI:91192) has part (S)-KI16425 (CHEBI:91195) |
| (R)-KI16425 (CHEBI:91197) is enantiomer of (S)-KI16425 (CHEBI:91195) |
| IUPAC Name |
|---|
| 3-[({4-[4-({[(1S)-1-(2-chlorophenyl)ethoxy]carbonyl}amino)-3-methyl-1,2-oxazol-5-yl]phenyl}methyl)sulfanyl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22835199 | Reaxys |