EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18FN3O2 |
| Net Charge | 0 |
| Average Mass | 375.403 |
| Monoisotopic Mass | 375.13831 |
| SMILES | Cc1cc(F)c(Nc2ncnc3cc(OCc4ccccc4)ccc23)cc1O |
| InChI | InChI=1S/C22H18FN3O2/c1-14-9-18(23)20(11-21(14)27)26-22-17-8-7-16(10-19(17)24-13-25-22)28-12-15-5-3-2-4-6-15/h2-11,13,27H,12H2,1H3,(H,24,25,26) |
| InChIKey | NVBNDZZLJRYRPD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ZM 323881 (CHEBI:91185) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| ZM 323881 (CHEBI:91185) is a aromatic ether (CHEBI:35618) |
| ZM 323881 (CHEBI:91185) is a benzyl ether (CHEBI:59859) |
| ZM 323881 (CHEBI:91185) is a fluorophenol (CHEBI:142486) |
| ZM 323881 (CHEBI:91185) is a halophenol (CHEBI:38856) |
| ZM 323881 (CHEBI:91185) is a monofluorobenzenes (CHEBI:83575) |
| ZM 323881 (CHEBI:91185) is a organic cation (CHEBI:25697) |
| ZM 323881 (CHEBI:91185) is a quinazolines (CHEBI:38530) |
| ZM 323881 (CHEBI:91185) is a secondary amino compound (CHEBI:50995) |
| ZM 323881 (CHEBI:91185) is a substituted aniline (CHEBI:48975) |
| ZM 323881 (CHEBI:91185) is conjugate base of ZM 323881(1+) (CHEBI:91187) |
| Incoming Relation(s) |
| ZM 323881(1+) (CHEBI:91187) is conjugate acid of ZM 323881 (CHEBI:91185) |
| IUPAC Name |
|---|
| 5-{[7-(benzyloxy)quinazolin-4-yl]amino}-4-fluoro-2-methylphenol |
| Synonyms | Source |
|---|---|
| ZM323881 | ChEBI |
| ZM-323881 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-3513 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13137893 | Reaxys |