EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18FN3O2.HCl |
| Net Charge | 0 |
| Average Mass | 411.864 |
| Monoisotopic Mass | 411.11498 |
| SMILES | Cc1cc(F)c(Nc2ncnc3cc(OCc4ccccc4)ccc23)cc1O.Cl |
| InChI | InChI=1S/C22H18FN3O2.ClH/c1-14-9-18(23)20(11-21(14)27)26-22-17-8-7-16(10-19(17)24-13-25-22)28-12-15-5-3-2-4-6-15;/h2-11,13,27H,12H2,1H3,(H,24,25,26);1H |
| InChIKey | AVRHWGLIYGJSOD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ZM 323881 hydrochloride (CHEBI:91182) has part ZM 323881(1+) (CHEBI:91187) |
| ZM 323881 hydrochloride (CHEBI:91182) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| ZM 323881 hydrochloride (CHEBI:91182) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| ZM 323881 hydrochloride (CHEBI:91182) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 7-(benzyloxy)-N-(2-fluoro-5-hydroxy-4-methylphenyl)quinazolin-4-aminium chloride |
| 5-{[7-(benzyloxy)quinazolin-4-yl]amino}-4-fluoro-2-methylphenol hydrochloride |
| Synonyms | Source |
|---|---|
| ZM 323881.HCl | ChEBI |
| ZM 323881 monohydrochloride | ChEBI |
| ZM-323881.HCl | ChEBI |
| ZM-323881 monohydrochloride | ChEBI |
| ZM-323881 hydrochloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13172661 | Reaxys |