EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O7S |
| Net Charge | 0 |
| Average Mass | 308.352 |
| Monoisotopic Mass | 308.09297 |
| SMILES | O=C(O)C[C@H]1CCC(=O)[C@@H]1CCCCCOS(=O)(=O)O |
| InChI | InChI=1S/C12H20O7S/c13-11-6-5-9(8-12(14)15)10(11)4-2-1-3-7-19-20(16,17)18/h9-10H,1-8H2,(H,14,15)(H,16,17,18)/t9-,10-/m1/s1 |
| InChIKey | CJUJDLFIAYZPPV-NXEZZACHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| root (BTO:0001188) | PubMed (25457500) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-sulfooxy-9,10-dihydrojasmonic acid (CHEBI:91169) has role plant metabolite (CHEBI:76924) |
| 12-sulfooxy-9,10-dihydrojasmonic acid (CHEBI:91169) is a alkyl sulfate (CHEBI:29281) |
| 12-sulfooxy-9,10-dihydrojasmonic acid (CHEBI:91169) is a dihydrojasmonic acid (CHEBI:23747) |
| IUPAC Name |
|---|
| {(1R,2R)-3-oxo-2-[5-(sulfooxy)pentyl]cyclopentyl}acetic acid |
| Synonym | Source |
|---|---|
| 9,10-Dihydrohydroxy-JA Sulfate | ChEBI |