EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7NO2 |
| Net Charge | 0 |
| Average Mass | 161.160 |
| Monoisotopic Mass | 161.04768 |
| SMILES | [H]C(=O)c1cnc2cccc(O)c12 |
| InChI | InChI=1S/C9H7NO2/c11-5-6-4-10-7-2-1-3-8(12)9(6)7/h1-5,10,12H |
| InChIKey | QLBZIZLLMNWTHG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| root (BTO:0001188) | PubMed (25457500) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyindole-3-carbaldehyde (CHEBI:91162) has role plant metabolite (CHEBI:76924) |
| 4-hydroxyindole-3-carbaldehyde (CHEBI:91162) is a heteroarenecarbaldehyde (CHEBI:49104) |
| 4-hydroxyindole-3-carbaldehyde (CHEBI:91162) is a hydroxyindoles (CHEBI:84729) |
| IUPAC Name |
|---|
| 4-hydroxy-1H-indole-3-carbaldehyde |
| Synonyms | Source |
|---|---|
| 4-HO-I3CHO | ChEBI |
| 4-hydroxy-3-indolecarbaldehyde | ChEBI |
| 4-hydroxy-3-formylindole | ChEBI |
| 4-hydroxy-3-indolecarboxaldehyde | ChEBI |
| 4-hydroxyindole-3-carbaldehyde | ChEBI |
| 4-hydroxyindole-3-carboxaldehyde | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5506995 | Reaxys |