EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O |
| Net Charge | 0 |
| Average Mass | 176.219 |
| Monoisotopic Mass | 176.09496 |
| SMILES | COn1cc(CN)c2ccccc21 |
| InChI | InChI=1S/C10H12N2O/c1-13-12-7-8(6-11)9-4-2-3-5-10(9)12/h2-5,7H,6,11H2,1H3 |
| InChIKey | GAHLHXRCZDVQSW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methoxy-3-(aminomethyl)indole (CHEBI:91161) has role plant metabolite (CHEBI:76924) |
| 1-methoxy-3-(aminomethyl)indole (CHEBI:91161) is a aminoalkylindole (CHEBI:38631) |
| IUPAC Name |
|---|
| 1-(1-methoxy-1H-indol-3-yl)methanamine |
| Synonyms | Source |
|---|---|
| 1-MeO-I3CH2NH2 | ChEBI |
| (1-methoxyindol-3-yl)methylamine | ChEBI |
| 1-methoxyindole-3-methanamine | ChEBI |
| 1-methoxyindole-3-methylamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4181754 | Reaxys |
| Citations |
|---|