EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H21NOS |
| Net Charge | 0 |
| Average Mass | 191.340 |
| Monoisotopic Mass | 191.13439 |
| SMILES | CS(=O)CCCCCCCCN |
| InChI | InChI=1S/C9H21NOS/c1-12(11)9-7-5-3-2-4-6-8-10/h2-10H2,1H3 |
| InChIKey | SSWZIHDEYOORCA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(methylsulfinyl)octylamine (CHEBI:91158) has role plant metabolite (CHEBI:76924) |
| 8-(methylsulfinyl)octylamine (CHEBI:91158) is a primary amino compound (CHEBI:50994) |
| 8-(methylsulfinyl)octylamine (CHEBI:91158) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 8-(methanesulfinyl)octan-1-amine |
| Synonyms | Source |
|---|---|
| 8-MeSO-octyl-NH2 | ChEBI |
| 8-methylsulfinyloctylamine | ChEBI |
| 8-(methylsulfinyl)-1-aminooctane | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28063961 | Reaxys |
| Citations |
|---|