EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O3S |
| Net Charge | 0 |
| Average Mass | 220.334 |
| Monoisotopic Mass | 220.11332 |
| SMILES | CS(=O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H20O3S/c1-14(13)9-7-5-3-2-4-6-8-10(11)12/h2-9H2,1H3,(H,11,12) |
| InChIKey | XZYIQKMSOAQJCG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-(methylsulfinyl)nonanoic acid (CHEBI:91156) has functional parent nonanoic acid (CHEBI:29019) |
| 9-(methylsulfinyl)nonanoic acid (CHEBI:91156) has role plant metabolite (CHEBI:76924) |
| 9-(methylsulfinyl)nonanoic acid (CHEBI:91156) is a monocarboxylic acid (CHEBI:25384) |
| 9-(methylsulfinyl)nonanoic acid (CHEBI:91156) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 9-(methanesulfinyl)nonanoic acid |
| Synonym | Source |
|---|---|
| 8-MeSO-octyl-CO2H | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28063958 | Reaxys |
| Citations |
|---|