EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19NOS2 |
| Net Charge | 0 |
| Average Mass | 233.402 |
| Monoisotopic Mass | 233.09081 |
| SMILES | CS(=O)CCCCCCCCN=C=S |
| InChI | InChI=1S/C10H19NOS2/c1-14(12)9-7-5-3-2-4-6-8-11-10-13/h2-9H2,1H3 |
| InChIKey | BCRXKWOQVFKZAG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| Diplotaxis harra (ncbitaxon:308281) | whole plant (BTO:0001461) | PubMed (10404541) | |
| Erucaria microcarpa (ncbitaxon:1078594) | whole plant (BTO:0001461) | PubMed (10404541) | |
| Rorippa indica (ncbitaxon:50499) | root (BTO:0001188) | PubMed (24254774) | |
| Rorippa sylvestris (ncbitaxon:65952) | - | PubMed (24253962) |
| Roles Classification |
|---|
| Biological Roles: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(methylsulfinyl)octyl isothiocyanate (CHEBI:91152) has parent hydride octane (CHEBI:17590) |
| 8-(methylsulfinyl)octyl isothiocyanate (CHEBI:91152) has role allelochemical (CHEBI:62215) |
| 8-(methylsulfinyl)octyl isothiocyanate (CHEBI:91152) has role plant metabolite (CHEBI:76924) |
| 8-(methylsulfinyl)octyl isothiocyanate (CHEBI:91152) is a isothiocyanate (CHEBI:52221) |
| 8-(methylsulfinyl)octyl isothiocyanate (CHEBI:91152) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 1-isothiocyanato-8-(methylsulfinyl)octane |
| Synonyms | Source |
|---|---|
| 8-MeSO-octyl-NCS | ChEBI |
| 8-methylsulfinyloctyl isothiocyanate | ChEBI |
| hirsutin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0035923 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1708483 | Reaxys |
| CAS:31456-68-5 | HMDB |
| Citations |
|---|