EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2O2 |
| Net Charge | 0 |
| Average Mass | 216.240 |
| Monoisotopic Mass | 216.08988 |
| SMILES | O=C(O)C1Cc2c(nc3ccccc23)CN1 |
| InChI | InChI=1S/C12H12N2O2/c15-12(16)10-5-8-7-3-1-2-4-9(7)14-11(8)6-13-10/h1-4,10,13-14H,5-6H2,(H,15,16) |
| InChIKey | FSNCEEGOMTYXKY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| root (BTO:0001188) | PubMed (25457500) | ||
| Citrus limon (ncbitaxon:2708) | fruit (BTO:0000486) | PubMed (10606547) | |
| Citrus reticulata (ncbitaxon:85571) | fruit (BTO:0000486) | PubMed (10606547) | |
| Citrus sinensis (ncbitaxon:2711) | fruit (BTO:0000486) | PubMed (10606547) | |
| Citrus x paradisi (ncbitaxon:37656) | fruit (BTO:0000486) | PubMed (10606547) | |
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (2019874) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (8452569) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,3,4-tetrahydro-β-carboline-3-carboxylic acid (CHEBI:91151) has role human urinary metabolite (CHEBI:84087) |
| 1,2,3,4-tetrahydro-β-carboline-3-carboxylic acid (CHEBI:91151) has role human xenobiotic metabolite (CHEBI:76967) |
| 1,2,3,4-tetrahydro-β-carboline-3-carboxylic acid (CHEBI:91151) has role plant metabolite (CHEBI:76924) |
| 1,2,3,4-tetrahydro-β-carboline-3-carboxylic acid (CHEBI:91151) has role rat metabolite (CHEBI:86264) |
| 1,2,3,4-tetrahydro-β-carboline-3-carboxylic acid (CHEBI:91151) is a aromatic amino acid (CHEBI:33856) |
| 1,2,3,4-tetrahydro-β-carboline-3-carboxylic acid (CHEBI:91151) is a α-amino acid (CHEBI:33704) |
| 1,2,3,4-tetrahydro-β-carboline-3-carboxylic acid (CHEBI:91151) is a β-carboline alkaloid (CHEBI:83325) |
| IUPAC Name |
|---|
| 2,3,4,9-tetrahydro-1H-β-carboline-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1,2,3,4-Tetrahydro-beta-carboline-3-carboxylic acid | ChemIDplus |
| 3-Carboxy-1,2,3,4-tetrahydro-2-carboline | ChEBI |
| CCRIS 6486 | ChemIDplus |
| NSC 96912 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:86484 | Reaxys |
| CAS:6052-68-2 | ChemIDplus |
| Citations |
|---|