EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O3 |
| Net Charge | 0 |
| Average Mass | 278.352 |
| Monoisotopic Mass | 278.16304 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H22N2O3/c1-10(2)8-13(15(19)20)17-14(18)12(16)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9,16H2,1-2H3,(H,17,18)(H,19,20)/t12-,13-/m0/s1 |
| InChIKey | RFCVXVPWSPOMFJ-STQMWFEESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Leu (CHEBI:91150) has role plant metabolite (CHEBI:76924) |
| Phe-Leu (CHEBI:91150) is a dipeptide (CHEBI:46761) |
| Phe-Leu (CHEBI:91150) is tautomer of Phe-Leu zwitterion (CHEBI:190710) |
| Incoming Relation(s) |
| Phe-Leu zwitterion (CHEBI:190710) is tautomer of Phe-Leu (CHEBI:91150) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-leucine |
| Synonyms | Source |
|---|---|
| FL | ChEBI |
| phenylalanyl-leucine | ChEBI |
| phenylalanylleucine | ChEBI |
| L-Phe-L-Leu | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2814491 | Reaxys |
| CAS:3303-55-7 | ChemIDplus |
| Citations |
|---|