EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCC[C@@H](O)/C=C/C=C\C/C=C\C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-9-13-18(21)14-10-7-5-4-6-8-11-15-19(22)16-12-17-20(23)24/h5-8,10-11,14-15,18-19,21-22H,2-4,9,12-13,16-17H2,1H3,(H,23,24)/b7-5-,8-6-,14-10+,15-11+/t18-,19-/m1/s1 |
| InChIKey | UXGXCGPWGSUMNI-YLMOWEDUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (22068350) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5(S),15(R)-DiHETE (CHEBI:91138) has role human xenobiotic metabolite (CHEBI:76967) |
| 5(S),15(R)-DiHETE (CHEBI:91138) is a dihydroxyicosatetraenoic acid (CHEBI:72868) |
| 5(S),15(R)-DiHETE (CHEBI:91138) is conjugate acid of 5(S),15(R)-DiHETE(1−) (CHEBI:90812) |
| Incoming Relation(s) |
| 5(S),15(R)-DiHETE(1−) (CHEBI:90812) is conjugate base of 5(S),15(R)-DiHETE (CHEBI:91138) |
| IUPAC Name |
|---|
| (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoic acid |
| Synonyms | Source |
|---|---|
| (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosatetraenoic acid | ChEBI |
| 5S,15R-diHETE | LIPID MAPS |
| 5S,15R-dihydroxy-6E,8Z,11Z,13E-eicosatetraenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03060096 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20544168 | Reaxys |
| Citations |
|---|