EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | [H]C(=O)/C=C(C)/C=C/[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C |
| InChI | InChI=1S/C15H22O3/c1-11(6-8-16)5-7-15-13(2,3)9-12(17)10-14(15,4)18-15/h5-8,12,17H,9-10H2,1-4H3/b7-5+,11-6+/t12-,14+,15-/m0/s1 |
| InChIKey | ZTALKMXOHWQNIA-LVMPZUNDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pueraria montana (ncbitaxon:132459) | leaf (BTO:0000713) | PubMed (12809718) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-trans,4-trans-xanthoxin (CHEBI:91126) has role plant growth retardant (CHEBI:35219) |
| 2-trans,4-trans-xanthoxin (CHEBI:91126) has role plant metabolite (CHEBI:76924) |
| 2-trans,4-trans-xanthoxin (CHEBI:91126) is a apo carotenoid sesquiterpenoid (CHEBI:36758) |
| 2-trans,4-trans-xanthoxin (CHEBI:91126) is a enal (CHEBI:51688) |
| 2-trans,4-trans-xanthoxin (CHEBI:91126) is a epoxide (CHEBI:32955) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-1-yl]-3-methylpenta-2,4-dienal |
| Synonyms | Source |
|---|---|
| 2E,4E-xanthoxin | SUBMITTER |
| (E,E)-xanthoxin | ChEBI |
| trans,trans-Xanthoxin | KNApSAcK |
| UniProt Name | Source |
|---|---|
| 2-trans,4-trans-xanthoxin | UniProt |
| Citations |
|---|