EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O3 |
| Net Charge | 0 |
| Average Mass | 188.227 |
| Monoisotopic Mass | 188.11609 |
| SMILES | CCCCN(CCCC(=O)O)N=O |
| InChI | InChI=1S/C8H16N2O3/c1-2-3-6-10(9-13)7-4-5-8(11)12/h2-7H2,1H3,(H,11,12) |
| InChIKey | OAAQPYUFAOHUMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-butyl-N-(3-carboxypropyl)nitrosamine (CHEBI:91112) has functional parent N-butyl-N-(4-hydroxybutyl)nitrosamine (CHEBI:91275) |
| N-butyl-N-(3-carboxypropyl)nitrosamine (CHEBI:91112) has role carcinogenic agent (CHEBI:50903) |
| N-butyl-N-(3-carboxypropyl)nitrosamine (CHEBI:91112) is a monocarboxylic acid (CHEBI:25384) |
| N-butyl-N-(3-carboxypropyl)nitrosamine (CHEBI:91112) is a nitrosamine (CHEBI:35803) |
| IUPAC Name |
|---|
| 4-[butyl(nitroso)amino]butanoic acid |
| Synonyms | Source |
|---|---|
| 4-(butylnitrosoamino)butanoic acid | ChemIDplus |
| 4-(N-butyl-N-nitrosamino)butyric acid | ChEBI |
| BCN | ChEBI |
| BCPN | ChemIDplus |
| BRN 2257968 | ChemIDplus |
| butyl(3-carboxypropyl)nitrosamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2257968 | Reaxys |
| CAS:38252-74-3 | ChemIDplus |
| Citations |
|---|