EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO |
| Net Charge | 0 |
| Average Mass | 135.166 |
| Monoisotopic Mass | 135.06841 |
| SMILES | CC(=O)c1ccccc1N |
| InChI | InChI=1S/C8H9NO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,9H2,1H3 |
| InChIKey | GTDQGKWDWVUKTI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas aeruginosa (ncbitaxon:287) | - | PubMed (25043228) | |
| Sus scrofa domesticus (ncbitaxon:9825) | - | PubMed (26804051) | skatole metabolite Strain: Pietrain × Baden-Württemberg hybrid |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| o-aminoacetophenone (CHEBI:91110) has role bacterial metabolite (CHEBI:76969) |
| o-aminoacetophenone (CHEBI:91110) is a acetophenones (CHEBI:22187) |
| o-aminoacetophenone (CHEBI:91110) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 1-(2-aminophenyl)ethanone |
| Synonyms | Source |
|---|---|
| 1-acetyl-2-aminobenzene | ChemIDplus |
| 1-acetyl-2-aminobenzene | NIST Chemistry WebBook |
| 2-acetylaniline | NIST Chemistry WebBook |
| 2-acetylphenylamine | NIST Chemistry WebBook |
| 2-aminoacetophenone | ChemIDplus |
| 2'-aminoacetophenone | NIST Chemistry WebBook |
| Citations |
|---|