EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10ClN3O5 |
| Net Charge | 0 |
| Average Mass | 359.725 |
| Monoisotopic Mass | 359.03090 |
| SMILES | O=C1NC(=O)C(c2ccccc2[N+](=O)[O-])=C1Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C16H10ClN3O5/c17-10-7-8(5-6-12(10)21)18-14-13(15(22)19-16(14)23)9-3-1-2-4-11(9)20(24)25/h1-7,21H,(H2,18,19,22,23) |
| InChIKey | PQCXVIPXISBFPN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB 415286 (CHEBI:91107) has role antioxidant (CHEBI:22586) |
| SB 415286 (CHEBI:91107) has role apoptosis inducer (CHEBI:68495) |
| SB 415286 (CHEBI:91107) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| SB 415286 (CHEBI:91107) has role neuroprotective agent (CHEBI:63726) |
| SB 415286 (CHEBI:91107) is a C-nitro compound (CHEBI:35716) |
| SB 415286 (CHEBI:91107) is a maleimides (CHEBI:55417) |
| SB 415286 (CHEBI:91107) is a monochlorobenzenes (CHEBI:83403) |
| SB 415286 (CHEBI:91107) is a phenols (CHEBI:33853) |
| SB 415286 (CHEBI:91107) is a secondary amino compound (CHEBI:50995) |
| SB 415286 (CHEBI:91107) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 3-(3-chloro-4-hydroxyanilino)-4-(2-nitrophenyl)-1H-pyrrole-2,5-dione |
| Synonyms | Source |
|---|---|
| 3-(3-chloro-4-hydroxyphenylamino)-4-(4-nitrophenyl)-1H-pyrrole-2,5-dione | ChemIDplus |
| SB-415286 | ChemIDplus |
| SB415286 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-3719 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8795652 | Reaxys |
| CAS:264218-23-7 | ChemIDplus |
| Citations |
|---|