EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18Cl2N8 |
| Net Charge | 0 |
| Average Mass | 465.348 |
| Monoisotopic Mass | 464.10315 |
| SMILES | Cc1cnc(-c2cnc(NCCNc3ccc(C#N)cn3)nc2-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C22H18Cl2N8/c1-13-10-29-21(31-13)17-12-30-22(32-20(17)16-4-3-15(23)8-18(16)24)27-7-6-26-19-5-2-14(9-25)11-28-19/h2-5,8,10-12H,6-7H2,1H3,(H,26,28)(H,29,31)(H,27,30,32) |
| InChIKey | AQGNHMOJWBZFQQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CHIR 99021 (CHEBI:91091) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| CHIR 99021 (CHEBI:91091) is a aminopyridine (CHEBI:38207) |
| CHIR 99021 (CHEBI:91091) is a aminopyrimidine (CHEBI:38338) |
| CHIR 99021 (CHEBI:91091) is a cyanopyridine (CHEBI:23438) |
| CHIR 99021 (CHEBI:91091) is a diamine (CHEBI:23666) |
| CHIR 99021 (CHEBI:91091) is a dichlorobenzene (CHEBI:23697) |
| CHIR 99021 (CHEBI:91091) is a imidazoles (CHEBI:24780) |
| CHIR 99021 (CHEBI:91091) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 6-[(2-{[4-(2,4-dichlorophenyl)-5-(4-methyl-1H-imidazol-2-yl)pyrimidin-2-yl]amino}ethyl)amino]pyridine-3-carbonitrile |
| Synonyms | Source |
|---|---|
| CHIR-99021 | ChemIDplus |
| CHIR99021 | ChemIDplus |
| CT-99021 | ChemIDplus |
| CHIR-911 | ChemIDplus |
| 6-((2-((4-(2,4-Dichlorophenyl)-5-(4-methyl-1H-imidazol-2-yl)pyrimidin-2-yl)amino)ethyl)amino)nicotinonitrile | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-1181 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25763160 | Reaxys |
| CAS:252917-06-9 | ChemIDplus |
| Citations |
|---|