EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O3 |
| Net Charge | 0 |
| Average Mass | 310.353 |
| Monoisotopic Mass | 310.13174 |
| SMILES | Cc1nc(C=C2C(=O)Nc3ccccc32)c(C)c1CCC(=O)O |
| InChI | InChI=1S/C18H18N2O3/c1-10-12(7-8-17(21)22)11(2)19-16(10)9-14-13-5-3-4-6-15(13)20-18(14)23/h3-6,9,19H,7-8H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | NHFDRBXTEDBWCZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orantinib (CHEBI:91088) has functional parent 3-methyleneoxindole (CHEBI:17920) |
| orantinib (CHEBI:91088) has role antineoplastic agent (CHEBI:35610) |
| orantinib (CHEBI:91088) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| orantinib (CHEBI:91088) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| orantinib (CHEBI:91088) is a monocarboxylic acid (CHEBI:25384) |
| orantinib (CHEBI:91088) is a oxindoles (CHEBI:38459) |
| orantinib (CHEBI:91088) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| 3-{2,4-dimethyl-5-[(2-oxo-1,2-dihydro-3H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl}propanoic acid |
| INN | Source |
|---|---|
| orantinib | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(2,4-Dimethyl-5-(2-oxo-1,2-dihydroindol-3-ylidenemethyl)-1H-pyrrol-3-yl)propionic acid | ChemIDplus |
| 3-(4-(2-Carboxyethyl)-3,5-dimethylpyrrol-2-methylidenyl)-2-indolinone | ChemIDplus |
| 5-((1,2-Dihydro-2-oxo-3H-indol-3-ylidene)methyl)-2,4-dimethyl-1H-pyrrole-3-propanoic acid | ChemIDplus |
| SU 6668 | ChemIDplus |
| SU-6668 | ChemIDplus |
| SU6668 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-5664 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14609648 | Reaxys |
| CAS:252916-29-3 | ChemIDplus |
| Citations |
|---|