EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:91087 - Solvent yellow 56
| Formula | C16H19N3 |
| Net Charge | 0 |
| Average Mass | 253.349 |
| Monoisotopic Mass | 253.15790 |
| SMILES | CCN(CC)c1ccc(N=Nc2ccccc2)cc1 |
| InChI | InChI=1S/C16H19N3/c1-3-19(4-2)16-12-10-15(11-13-16)18-17-14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3 |
| InChIKey | SJJISKLXUJVZOA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Solvent yellow 56 (CHEBI:91087) has role dye (CHEBI:37958) |
| Solvent yellow 56 (CHEBI:91087) has role mutagen (CHEBI:25435) |
| Solvent yellow 56 (CHEBI:91087) is a azobenzenes (CHEBI:22682) |
| Solvent yellow 56 (CHEBI:91087) is a substituted aniline (CHEBI:48975) |
| Solvent yellow 56 (CHEBI:91087) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N,N-diethyl-4-(phenyldiazenyl)aniline |
| Synonyms | Source |
|---|---|
| Oil yellow DE | ChEBI |
| C.I. 11021 | ChEBI |
| 4-Phenylazo-N,N-diethylaniline | ChemIDplus |
| N,N-Diethyl-4-aminoazobenzene | ChemIDplus |
| 4-(Diethylamino)azobenzene | ChemIDplus |
| Diethylaminoazobenzene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Oil_Yellow_DE | Wikipedia |
| Citations |
|---|