EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C3H6N2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 256.262 |
| Monoisotopic Mass | 256.11715 |
| SMILES | N#CCCN.N#CCCN.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C4H4O4.2C3H6N2/c5-3(6)1-2-4(7)8;2*4-2-1-3-5/h1-2H,(H,5,6)(H,7,8);2*1-2,4H2/b2-1+;; |
| InChIKey | NYMXYZMHOZAPHQ-SEPHDYHBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | collagen cross-linking inhibitor Any compound that inhibits collagen cross-linking. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-aminopropionitrile hemifumarate (CHEBI:91084) has part β-ammoniopropionitrile (CHEBI:91086) |
| β-aminopropionitrile hemifumarate (CHEBI:91084) has role antineoplastic agent (CHEBI:35610) |
| β-aminopropionitrile hemifumarate (CHEBI:91084) has role antirheumatic drug (CHEBI:35842) |
| β-aminopropionitrile hemifumarate (CHEBI:91084) has role collagen cross-linking inhibitor (CHEBI:91085) |
| β-aminopropionitrile hemifumarate (CHEBI:91084) has role plant metabolite (CHEBI:76924) |
| β-aminopropionitrile hemifumarate (CHEBI:91084) is a fumarate salt (CHEBI:50921) |
| IUPAC Name |
|---|
| bis(2-cyanoethan-1-aminium) (2E)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 2-cyanoethylamine hemifumarate | ChEBI |
| BAPN fumarate | ChemIDplus |
| beta-Aminopropionitrile, fumarate | ChemIDplus |
| Bis(3-aminopropionitrile) fumarate | ChemIDplus |
| Di-beta-aminopropionitrile fumarate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Aminopropionitrile | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3573532 | Reaxys |
| CAS:2079-89-2 | ChemIDplus |
| Citations |
|---|