EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O |
| Net Charge | 0 |
| Average Mass | 238.290 |
| Monoisotopic Mass | 238.11061 |
| SMILES | Cc1cc(C)c(/C=C2\C(=O)Nc3ccccc32)n1 |
| InChI | InChI=1S/C15H14N2O/c1-9-7-10(2)16-14(9)8-12-11-5-3-4-6-13(11)17-15(12)18/h3-8,16H,1-2H3,(H,17,18)/b12-8- |
| InChIKey | WUWDLXZGHZSWQZ-WQLSENKSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Applications: | angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| semaxanib (CHEBI:91083) has functional parent 3-methyleneoxindole (CHEBI:17920) |
| semaxanib (CHEBI:91083) has role angiogenesis modulating agent (CHEBI:50926) |
| semaxanib (CHEBI:91083) has role antineoplastic agent (CHEBI:35610) |
| semaxanib (CHEBI:91083) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| semaxanib (CHEBI:91083) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| semaxanib (CHEBI:91083) is a olefinic compound (CHEBI:78840) |
| semaxanib (CHEBI:91083) is a oxindoles (CHEBI:38459) |
| semaxanib (CHEBI:91083) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1,3-dihydro-2H-indol-2-one |
| INN | Source |
|---|---|
| semaxanib | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 3-(1-(3,5-Dimethyl-1H-pyrrol-2-yl)meth-(Z)-ylidene)-2-oxo-2,3-dihydroindole | ChemIDplus |
| 3-[(2,4-dimethylpyrrol-5-yl)methylidenyl]-2-indolinone | ChEBI |
| 3-((Z)-(3,5-Dimethylpyrrol-2-yl)methylene)-2-indolinone | ChemIDplus |
| SU 5416 | ChemIDplus |
| SU5416 | ChemIDplus |
| TSU 16 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| semaxanib | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7995521 | Reaxys |
| CAS:194413-58-6 | ChemIDplus |
| CAS:194413-58-6 | KEGG DRUG |
| Citations |
|---|