EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14BrN3O2 |
| Net Charge | 0 |
| Average Mass | 360.211 |
| Monoisotopic Mass | 359.02694 |
| SMILES | COc1cc2ncnc(Nc3cccc(Br)c3)c2cc1OC |
| InChI | InChI=1S/C16H14BrN3O2/c1-21-14-7-12-13(8-15(14)22-2)18-9-19-16(12)20-11-5-3-4-10(17)6-11/h3-9H,1-2H3,(H,18,19,20) |
| InChIKey | LSPANGZZENHZNJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PD-153035 (CHEBI:91076) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| PD-153035 (CHEBI:91076) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| PD-153035 (CHEBI:91076) is a aromatic amine (CHEBI:33860) |
| PD-153035 (CHEBI:91076) is a aromatic ether (CHEBI:35618) |
| PD-153035 (CHEBI:91076) is a bromobenzenes (CHEBI:37149) |
| PD-153035 (CHEBI:91076) is a quinazolines (CHEBI:38530) |
| PD-153035 (CHEBI:91076) is a secondary amino compound (CHEBI:50995) |
| PD-153035 (CHEBI:91076) is conjugate base of PD-153035(1+) (CHEBI:91077) |
| Incoming Relation(s) |
| PD-153035(1+) (CHEBI:91077) is conjugate acid of PD-153035 (CHEBI:91076) |
| IUPAC Name |
|---|
| N-(3-bromophenyl)-6,7-dimethoxyquinazolin-4-amine |
| Synonyms | Source |
|---|---|
| (3-Bromophenyl)(6,7-dimethoxyquinazolin-4-yl)amine | ChemIDplus |
| 4-(3-Bromophenylamino)-6,7-dimethoxyquinazoline | ChemIDplus |
| AG-1517 | ChemIDplus |
| NSC-669364 | ChemIDplus |
| PD 153035 | ChEBI |
| PD153035 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7384032 | Reaxys |
| CAS:153436-54-5 | ChemIDplus |
| Citations |
|---|