EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14BrN3O2.HCl |
| Net Charge | 0 |
| Average Mass | 396.672 |
| Monoisotopic Mass | 395.00362 |
| SMILES | COc1cc2ncnc(Nc3cccc(Br)c3)c2cc1OC.Cl |
| InChI | InChI=1S/C16H14BrN3O2.ClH/c1-21-14-7-12-13(8-15(14)22-2)18-9-19-16(12)20-11-5-3-4-10(17)6-11;/h3-9H,1-2H3,(H,18,19,20);1H |
| InChIKey | ZJOKWAWPAPMNIM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PD-153035 hydrochloride (CHEBI:91075) has part PD-153035(1+) (CHEBI:91077) |
| PD-153035 hydrochloride (CHEBI:91075) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| PD-153035 hydrochloride (CHEBI:91075) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| PD-153035 hydrochloride (CHEBI:91075) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| N-(3-bromophenyl)-6,7-dimethoxyquinazolin-4-amine hydrochloride |
| N-(3-bromophenyl)-6,7-dimethoxyquinazolin-4-aminium chloride |
| Synonyms | Source |
|---|---|
| 4-[(3-bromophenyl)amino]-6,7-dimethoxyquinazoline hydrochloride | ChEBI |
| AG 1517 hydrochloride | ChemIDplus |
| PD 153035.HCl | ChEBI |
| PD-153035.HCl | ChEBI |
| PD153035.HCl | ChEBI |
| PD 153035 hydrochloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7400679 | Reaxys |
| CAS:183322-45-4 | ChemIDplus |
| Citations |
|---|