EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO4 |
| Net Charge | 0 |
| Average Mass | 313.353 |
| Monoisotopic Mass | 313.13141 |
| SMILES | CCOC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO4/c1-2-23-18(22)16(12-13-8-10-15(20)11-9-13)19-17(21)14-6-4-3-5-7-14/h3-11,16,20H,2,12H2,1H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | SRLROPAFMUDDRC-INIZCTEOSA-N |
| Roles Classification |
|---|
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl N-benzoyl-L-tyrosinate (CHEBI:91051) has role chromogenic compound (CHEBI:75050) |
| ethyl N-benzoyl-L-tyrosinate (CHEBI:91051) is a L-tyrosine derivative (CHEBI:27177) |
| ethyl N-benzoyl-L-tyrosinate (CHEBI:91051) is a benzamides (CHEBI:22702) |
| ethyl N-benzoyl-L-tyrosinate (CHEBI:91051) is a ethyl ester (CHEBI:23990) |
| ethyl N-benzoyl-L-tyrosinate (CHEBI:91051) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| ethyl N-benzoyl-L-tyrosinate |
| Synonyms | Source |
|---|---|
| PhCO-Tyr-OEt | ChEBI |
| N-Benzoyl-L-tyrosine ethyl ester | ChemIDplus |
| Benzoyltyrosine ethyl ester | ChemIDplus |
| Ethyl benzoyltyrosinate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2223819 | Reaxys |
| CAS:3483-82-7 | ChemIDplus |
| Citations |
|---|