EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10NO5P |
| Net Charge | 0 |
| Average Mass | 279.188 |
| Monoisotopic Mass | 279.02966 |
| SMILES | [H]P(=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H10NO5P/c14-13(15)10-6-8-12(9-7-10)18-19(16)17-11-4-2-1-3-5-11/h1-9,19H |
| InChIKey | YGTLRZOYPNTDJW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-nitrophenyl phenyl phosphonate (CHEBI:91050) has functional parent 4-nitrophenol (CHEBI:16836) |
| p-nitrophenyl phenyl phosphonate (CHEBI:91050) has functional parent phenol (CHEBI:15882) |
| p-nitrophenyl phenyl phosphonate (CHEBI:91050) has role chromogenic compound (CHEBI:75050) |
| p-nitrophenyl phenyl phosphonate (CHEBI:91050) is a aryl phosphonate (CHEBI:91046) |
| IUPAC Name |
|---|
| 4-nitrophenyl phenyl phosphonate |