EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7O3P |
| Net Charge | 0 |
| Average Mass | 158.093 |
| Monoisotopic Mass | 158.01328 |
| SMILES | [H]P(=O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C6H7O3P/c7-10(8)9-6-4-2-1-3-5-6/h1-5,10H,(H,7,8) |
| InChIKey | NQRYGPXAYYDKJB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenyl hydrogen phosphonate (CHEBI:91048) has functional parent phenol (CHEBI:15882) |
| phenyl hydrogen phosphonate (CHEBI:91048) has role chromogenic compound (CHEBI:75050) |
| phenyl hydrogen phosphonate (CHEBI:91048) is a aryl phosphonate (CHEBI:91046) |
| IUPAC Name |
|---|
| phenyl hydrogen phosphonate |
| Synonyms | Source |
|---|---|
| monophenyl phosphonate | ChEBI |
| phenyl phosphonate | ChEBI |
| phosphonic acid monophenyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1863788 | Reaxys |
| CAS:2310-89-6 | ChemIDplus |