EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O8S2 |
| Net Charge | 0 |
| Average Mass | 392.411 |
| Monoisotopic Mass | 392.03481 |
| SMILES | [H][C@@]1([C@H](C)OS(=O)(=O)O)C(=O)N2C(C(=O)O)=C(S/C=C/NC(C)=O)C[C@@]21[H] |
| InChI | InChI=1S/C13H16N2O8S2/c1-6(23-25(20,21)22)10-8-5-9(24-4-3-14-7(2)16)11(13(18)19)15(8)12(10)17/h3-4,6,8,10H,5H2,1-2H3,(H,14,16)(H,18,19)(H,20,21,22)/b4-3+/t6-,8+,10-/m0/s1 |
| InChIKey | FQQFFZPBGYGDSX-NJFHWYBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | |||
| - | MetaboLights (MTBLS36) | ||
| - | DOI (10.1038/sdata.2014.29) | ||
| Streptomyces olivaceus (ncbitaxon:47716) | - | Article (Brown,J. Antibiotics, 29, (1976), 668) | Strain: ATCC 21379 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epithienamycin E (CHEBI:91030) has role bacterial metabolite (CHEBI:76969) |
| epithienamycin E (CHEBI:91030) is a acetamides (CHEBI:22160) |
| epithienamycin E (CHEBI:91030) is a carbapenems (CHEBI:46633) |
| epithienamycin E (CHEBI:91030) is a organosulfonic acid (CHEBI:33551) |
| IUPAC Name |
|---|
| (5R,6R)-3-{[(E)-2-acetamidoethenyl]sulfanyl}-7-oxo-6-[(1S)-1-(sulfooxy)ethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| AB 110 D Antibiotic | ChemIDplus |
| AB-110-D Antibiotic | ChemIDplus |
| Antibiotic AB 110-D | ChemIDplus |
| Antibiotic MM 13902 | KNApSAcK |
| BRL 13902 | KNApSAcK |
| MM 13,902 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6450866 | Reaxys |
| CAS:79057-46-8 | KEGG COMPOUND |
| CAS:79057-46-8 | ChemIDplus |