EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15ClN2O2S |
| Net Charge | 0 |
| Average Mass | 238.740 |
| Monoisotopic Mass | 238.05428 |
| SMILES | CCOC(=O)C1CNC(SC)NC1Cl |
| InChI | InChI=1S/C8H15ClN2O2S/c1-3-13-7(12)5-4-10-8(14-2)11-6(5)9/h5-6,8,10-11H,3-4H2,1-2H3 |
| InChIKey | FYMQTZHJHCECFW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS149) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 4-chloro-2-(methylsulfanyl)hexahydropyrimidine-5-carboxylate (CHEBI:91029) is a aliphatic sulfide (CHEBI:22327) |
| ethyl 4-chloro-2-(methylsulfanyl)hexahydropyrimidine-5-carboxylate (CHEBI:91029) is a aminal (CHEBI:35412) |
| ethyl 4-chloro-2-(methylsulfanyl)hexahydropyrimidine-5-carboxylate (CHEBI:91029) is a amino-acid ester (CHEBI:46668) |
| ethyl 4-chloro-2-(methylsulfanyl)hexahydropyrimidine-5-carboxylate (CHEBI:91029) is a pyrimidinecarboxylate ester (CHEBI:48451) |
| IUPAC Name |
|---|
| ethyl 4-chloro-2-(methylsulfanyl)hexahydropyrimidine-5-carboxylate |
| Synonyms | Source |
|---|---|
| EBD2839740 | ChEBI |
| ethyl 4-chloro-2-(methylthio)hexahydropyrimidine-5-carboxylate | ChEBI |