EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H70O15 |
| Net Charge | 0 |
| Average Mass | 827.018 |
| Monoisotopic Mass | 826.47147 |
| SMILES | [H][C@@]12C[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@]3([H])C(C)(C)[C@@H](O[C@@H]4OC[C@@H](O)[C@H](O)[C@H]4OC(C)=O)CC[C@@]34C[C@@]14CC[C@@]1(C)[C@@]2(C)C[C@H](O)[C@]1([H])[C@@]1(C)CC[C@@H](C(C)(C)O)O1 |
| InChI | InChI=1S/C43H70O15/c1-20(45)54-32-28(48)22(47)18-53-36(32)57-26-10-12-43-19-42(43)14-13-39(6)33(41(8)11-9-27(58-41)38(4,5)52)21(46)16-40(39,7)25(42)15-23(34(43)37(26,2)3)55-35-31(51)30(50)29(49)24(17-44)56-35/h21-36,44,46-52H,9-19H2,1-8H3/t21-,22+,23-,24+,25-,26-,27-,28-,29+,30-,31+,32+,33-,34-,35+,36-,39+,40-,41+,42-,43+/m0/s1 |
| InChIKey | AYWNHWGQTMCQIV-PENCHUSISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Astragalus mongholicus (ncbitaxon:119829) | - | MetaboLights (MTBLS189) | |
| Astragalus membranaceus (ncbitaxon:649199) | - | PubMed (25068786) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astragaloside II (CHEBI:91026) has functional parent cycloastragenol (CHEBI:71314) |
| astragaloside II (CHEBI:91026) has role plant metabolite (CHEBI:76924) |
| astragaloside II (CHEBI:91026) is a monosaccharide derivative (CHEBI:63367) |
| astragaloside II (CHEBI:91026) is a oxolanes (CHEBI:26912) |
| astragaloside II (CHEBI:91026) is a pentacyclic triterpenoid (CHEBI:25872) |
| astragaloside II (CHEBI:91026) is a triterpenoid saponin (CHEBI:61778) |
| astragaloside II (CHEBI:91026) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,6α,9β,16β,20R,24S)-3-[(2-O-acetyl-β-D-xylopyranosyl)oxy]-16,25-dihydroxy-20,24-epoxy-9,19-cyclolanostan-6-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Astrasieversianin VIII | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5722138 | Reaxys |
| CAS:84676-89-1 | KEGG COMPOUND |
| CAS:91739-01-4 | ChemIDplus |
| Citations |
|---|