EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7NS |
| Net Charge | 0 |
| Average Mass | 125.196 |
| Monoisotopic Mass | 125.02992 |
| SMILES | Nc1ccccc1S |
| InChI | InChI=1S/C6H7NS/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2 |
| InChIKey | VRVRGVPWCUEOGV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mimosa pudica (ncbitaxon:76306) | root (BTO:0001188) | PubMed (26661932) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminothiophenol (CHEBI:91019) has role plant metabolite (CHEBI:76924) |
| 2-aminothiophenol (CHEBI:91019) is a aryl thiol (CHEBI:82711) |
| 2-aminothiophenol (CHEBI:91019) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-aminobenzene-1-thiol |
| Synonyms | Source |
|---|---|
| 1-Amino-2-mercaptobenzene | ChemIDplus |
| 2-Amino-1-mercaptobenzene | NIST Chemistry WebBook |
| 2-Aminobenzenethiol | ChemIDplus |
| 2-Aminophenyl mercaptan | NIST Chemistry WebBook |
| 2-Mercaptaniline | ChemIDplus |
| 2-Mercaptoaniline | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:606076 | Reaxys |
| CAS:137-07-5 | ChemIDplus |
| CAS:137-07-5 | NIST Chemistry WebBook |
| CAS:40451-21-6 | ChemIDplus |
| Citations |
|---|