EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O14P3 |
| Net Charge | -4 |
| Average Mass | 386.035 |
| Monoisotopic Mass | 385.92271 |
| SMILES | O=P([O-])([O-])OP(=O)([O-])OP(=O)([O-])OC[C@H]1OC(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H13O14P3/c6-3-2(17-5(8)4(3)7)1-16-21(12,13)19-22(14,15)18-20(9,10)11/h2-8H,1H2,(H,12,13)(H,14,15)(H2,9,10,11)/p-4/t2-,3-,4-,5?/m1/s1 |
| InChIKey | ZJJBHGDNOZLBIL-SOOFDHNKSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-ribose 5-triphosphate(4−) (CHEBI:91013) is a organophosphate oxoanion (CHEBI:58945) |
| D-ribose 5-triphosphate(4−) (CHEBI:91013) is conjugate base of D-ribose 5-triphosphate (CHEBI:28232) |
| Incoming Relation(s) |
| D-ribose 5-triphosphate (CHEBI:28232) is conjugate acid of D-ribose 5-triphosphate(4−) (CHEBI:91013) |
| UniProt Name | Source |
|---|---|
| D-ribose 5-triphosphate | UniProt |
| Citations |
|---|