EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4Cl2O4 |
| Net Charge | 0 |
| Average Mass | 211.000 |
| Monoisotopic Mass | 209.94866 |
| SMILES | O=C(O)/C=C\C(Cl)=C(\Cl)C(=O)O |
| InChI | InChI=1S/C6H4Cl2O4/c7-3(1-2-4(9)10)5(8)6(11)12/h1-2H,(H,9,10)(H,11,12)/b2-1-,5-3- |
| InChIKey | SOSGLWHQVQUMLM-NWJCXACMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. P51 (ncbitaxon:65067) | - | PubMed (2013566) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4Z)-2,3-dichloromuconic acid (CHEBI:91010) has role bacterial metabolite (CHEBI:76969) |
| (2Z,4Z)-2,3-dichloromuconic acid (CHEBI:91010) is a 2,3-dichloromuconic acid (CHEBI:111519) |
| (2Z,4Z)-2,3-dichloromuconic acid (CHEBI:91010) is conjugate acid of (2Z,4Z)-2,3-dichloromuconate(2−) (CHEBI:91011) |
| Incoming Relation(s) |
| (2Z,4Z)-2,3-dichloromuconate(2−) (CHEBI:91011) is conjugate base of (2Z,4Z)-2,3-dichloromuconic acid (CHEBI:91010) |
| IUPAC Name |
|---|
| (2Z,4Z)-2,3-dichlohexa-2,4-diendioic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2092046 | Reaxys |
| Citations |
|---|