EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O10 |
| Net Charge | 0 |
| Average Mass | 462.451 |
| Monoisotopic Mass | 462.15260 |
| SMILES | COc1ccc2c(c1OC)OC1c3ccc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc3OCC21 |
| InChI | InChI=1S/C23H26O10/c1-28-14-6-5-11-13-9-30-15-7-10(3-4-12(15)20(13)33-21(11)22(14)29-2)31-23-19(27)18(26)17(25)16(8-24)32-23/h3-7,13,16-20,23-27H,8-9H2,1-2H3/t13?,16-,17-,18+,19-,20?,23-/m1/s1 |
| InChIKey | PCIXSTFFMHVOMF-NFOIBEGASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Astragalus mongholicus (ncbitaxon:119829) | |||
| - | PubMed (25844502) | ||
| - | MetaboLights (MTBLS189) | ||
| root (BTO:0001188) | PubMed (15763368) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10-dimethoxypterocarpan-3-O-β-D-glucoside (CHEBI:91009) has role plant metabolite (CHEBI:76924) |
| 9,10-dimethoxypterocarpan-3-O-β-D-glucoside (CHEBI:91009) is a aromatic ether (CHEBI:35618) |
| 9,10-dimethoxypterocarpan-3-O-β-D-glucoside (CHEBI:91009) is a monosaccharide derivative (CHEBI:63367) |
| 9,10-dimethoxypterocarpan-3-O-β-D-glucoside (CHEBI:91009) is a pterocarpans (CHEBI:26377) |
| 9,10-dimethoxypterocarpan-3-O-β-D-glucoside (CHEBI:91009) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 9,10-dimethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c][1]benzopyran-3-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27695500 | Reaxys |
| Citations |
|---|