EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:91000 - resolvin E1(1−)
| Formula | C20H29O5 |
| Net Charge | -1 |
| Average Mass | 349.447 |
| Monoisotopic Mass | 349.20205 |
| SMILES | CC[C@@H](O)/C=C/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O5/c1-2-17(21)11-8-5-9-14-18(22)12-6-3-4-7-13-19(23)15-10-16-20(24)25/h3-9,11-13,17-19,21-23H,2,10,14-16H2,1H3,(H,24,25)/p-1/b4-3+,9-5-,11-8+,12-6+,13-7-/t17-,18+,19-/m1/s1 |
| InChIKey | AOPOCGPBAIARAV-OTBJXLELSA-M |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin E1(1−) (CHEBI:91000) has role anti-inflammatory agent (CHEBI:67079) |
| resolvin E1(1−) (CHEBI:91000) has role human xenobiotic metabolite (CHEBI:76967) |
| resolvin E1(1−) (CHEBI:91000) is a hydroxy fatty acid anion (CHEBI:59835) |
| resolvin E1(1−) (CHEBI:91000) is a icosanoid anion (CHEBI:62937) |
| resolvin E1(1−) (CHEBI:91000) is a long-chain fatty acid anion (CHEBI:57560) |
| resolvin E1(1−) (CHEBI:91000) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| resolvin E1(1−) (CHEBI:91000) is conjugate base of resolvin E1 (CHEBI:81559) |
| Incoming Relation(s) |
| resolvin E1 (CHEBI:81559) is conjugate acid of resolvin E1(1−) (CHEBI:91000) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate |
| Synonyms | Source |
|---|---|
| (5S,12R,18R)-trihydroxy-(6Z,8E,10E,14Z,16E)-eicosapentaenoate | SUBMITTER |
| (5S,12R,18R)-trihydroxy-(6Z,8E,10E,14Z,16E)-icosapentaenoate | ChEBI |
| RvE1(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| resolvin E1 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD66-57 | MetaCyc |
| Citations |
|---|