EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20ClNO5.HCl |
| Net Charge | 0 |
| Average Mass | 438.307 |
| Monoisotopic Mass | 437.07968 |
| SMILES | CN1CC[C@H](c2c(O)cc(O)c3c(=O)cc(-c4ccccc4Cl)oc23)[C@H](O)C1.Cl |
| InChI | InChI=1S/C21H20ClNO5.ClH/c1-23-7-6-12(17(27)10-23)19-14(24)8-15(25)20-16(26)9-18(28-21(19)20)11-4-2-3-5-13(11)22;/h2-5,8-9,12,17,24-25,27H,6-7,10H2,1H3;1H/t12-,17+;/m0./s1 |
| InChIKey | LGMSNQNWOCSPIK-LWHGMNCYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alvocidib hydrochloride (CHEBI:90998) has part alvocidib(1+) (CHEBI:90997) |
| alvocidib hydrochloride (CHEBI:90998) has role antineoplastic agent (CHEBI:35610) |
| alvocidib hydrochloride (CHEBI:90998) has role antirheumatic drug (CHEBI:35842) |
| alvocidib hydrochloride (CHEBI:90998) has role apoptosis inducer (CHEBI:68495) |
| alvocidib hydrochloride (CHEBI:90998) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| alvocidib hydrochloride (CHEBI:90998) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-(2-chlorophenyl)-5,7-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-4H-chromen-4-one hydrochloride |
| Synonyms | Source |
|---|---|
| (3S,4R)-4-[2-(2-chlorophenyl)-5,7-dihydroxy-4-oxo-4H-chromen-8-yl]-3-hydroxy-1-methylpiperidinium chloride | IUPAC |
| alvocidib HCl | ChEBI |
| HL 275 | ChemIDplus |
| HL-275 | ChemIDplus |
| HMR 1275 | ChemIDplus |
| HMR-1275 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:131740-09-5 | ChemIDplus |
| Citations |
|---|