EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | CC/C=C\C/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)O)OO |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-10-13-16-19(24-23)17-14-11-8-6-7-9-12-15-18-20(21)22/h3-4,7-11,13-14,17,19,23H,2,5-6,12,15-16,18H2,1H3,(H,21,22)/b4-3-,9-7-,11-8-,13-10-,17-14+/t19-/m0/s1 |
| InChIKey | HDMYXONNVAOHFR-UOLHMMFFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12(S)-HpEPE (CHEBI:90996) has role human xenobiotic metabolite (CHEBI:76967) |
| 12(S)-HpEPE (CHEBI:90996) is a 12-HPEPE (CHEBI:78909) |
| 12(S)-HpEPE (CHEBI:90996) is conjugate acid of 12(S)-HpEPE(1−) (CHEBI:90772) |
| Incoming Relation(s) |
| 12(S)-HpEPE(1−) (CHEBI:90772) is conjugate base of 12(S)-HpEPE (CHEBI:90996) |
| IUPAC Name |
|---|
| (5Z,8Z,10E,12S,14Z-17Z)-12-hydroperoxyicosa-5,8,10,14,17-pentaenoic acid |
| Synonyms | Source |
|---|---|
| 12S-HpEPE | ChEBI |
| (12S)-hydroperoxy-(5Z,8Z,10E,14Z-17Z)-eicosapentaenoic acid | ChEBI |
| (12S)-hydroperoxy-(5Z,8Z,10E,14Z-17Z)-icosapentaenoic acid | ChEBI |
| 12S-hydroperoxy-5Z,8Z,10E,14Z,17Z-eicosapentaenoic acid | LIPID MAPS |
| (5Z,8Z,10E,12S,14Z-17Z)-12-hydroperoxyicosapentaenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA03070012 | LIPID MAPS |
| Citations |
|---|