EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O3 |
| Net Charge | 0 |
| Average Mass | 322.489 |
| Monoisotopic Mass | 322.25079 |
| SMILES | CCCCC/C=C\C[C@H](O)/C=C/C=C\CCCCCCC(=O)O |
| InChI | InChI=1S/C20H34O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h8,10-11,13-14,17,19,21H,2-7,9,12,15-16,18H2,1H3,(H,22,23)/b11-8-,13-10-,17-14+/t19-/m0/s1 |
| InChIKey | YYIXZLMPKIFFGQ-ONNNWOQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (22984144) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12(S)-HETrE (CHEBI:90995) has functional parent all-cis-icosa-8,11,14-trienoic acid (CHEBI:53486) |
| 12(S)-HETrE (CHEBI:90995) has role human xenobiotic metabolite (CHEBI:76967) |
| 12(S)-HETrE (CHEBI:90995) is a HETrE (CHEBI:72793) |
| 12(S)-HETrE (CHEBI:90995) is conjugate acid of 12(S)-HETrE(1−) (CHEBI:90771) |
| Incoming Relation(s) |
| 12(S)-HETrE(1−) (CHEBI:90771) is conjugate base of 12(S)-HETrE (CHEBI:90995) |
| IUPAC Name |
|---|
| (8Z,10E,12S,14Z)-12-hydroxyicosa-8,10,14-trienoic acid |
| Synonyms | Source |
|---|---|
| (12S)-hydroxy-(8Z,10E,14Z)-icosatrienoic acid | ChEBI |
| 12S-HETrE | ChEBI |
| (12S)-hydroxy-(8Z,10E,14Z)-eicosatrienoic acid | ChEBI |
| Citations |
|---|