EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N4 |
| Net Charge | 0 |
| Average Mass | 214.272 |
| Monoisotopic Mass | 214.12185 |
| SMILES | Nc1ccc(-c2ccc(N)c(N)c2)cc1N |
| InChI | InChI=1S/C12H14N4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H,13-16H2 |
| InChIKey | HSTOKWSFWGCZMH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3'-diaminobenzidine (CHEBI:90994) has role histological dye (CHEBI:77178) |
| 3,3'-diaminobenzidine (CHEBI:90994) is a biphenyls (CHEBI:22888) |
| 3,3'-diaminobenzidine (CHEBI:90994) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| biphenyl-3,3',4,4'-tetramine |
| Synonyms | Source |
|---|---|
| 3,3',4,4'-tetraminobiphenyl | ChemIDplus |
| biphenyl-3,3',4,4'-tetrayltetraamine | NIST Chemistry WebBook |
| 3,3',4,4'-biphenyltetramine | ChemIDplus |
| 3,3',4,4'-tetraaminobiphenyl | ChemIDplus |
| (1,1'-biphenyl)-3,3',4,4'-tetramine | ChemIDplus |
| 3,3'-diaminobenzidine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3,3'-Diaminobenzidine | Wikipedia |
| Citations |
|---|