EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | O=C(O)CCC[C@H](O)/C=C/C=C/C=C/[C@H](O)C/C=C\CCCCCO |
| InChI | InChI=1S/C20H32O5/c21-17-10-6-2-1-3-7-12-18(22)13-8-4-5-9-14-19(23)15-11-16-20(24)25/h3-5,7-9,13-14,18-19,21-23H,1-2,6,10-12,15-17H2,(H,24,25)/b5-4+,7-3-,13-8+,14-9+/t18-,19-/m1/s1 |
| InChIKey | PTJFJXLGRSTECQ-BILTVKSSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxy-6-trans-leukotriene B4 (CHEBI:90992) has functional parent 6-trans-leukotriene B4 (CHEBI:63981) |
| 20-hydroxy-6-trans-leukotriene B4 (CHEBI:90992) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 20-hydroxy-6-trans-leukotriene B4 (CHEBI:90992) is a leukotriene (CHEBI:25029) |
| 20-hydroxy-6-trans-leukotriene B4 (CHEBI:90992) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 20-hydroxy-6-trans-leukotriene B4 (CHEBI:90992) is conjugate acid of 20-hydroxy-6-trans-leukotriene B4(1−) (CHEBI:90732) |
| Incoming Relation(s) |
| 20-hydroxy-6-trans-leukotriene B4(1−) (CHEBI:90732) is conjugate base of 20-hydroxy-6-trans-leukotriene B4 (CHEBI:90992) |
| IUPAC Name |
|---|
| (5S,6E,8E,10E,12R,14Z)-5,12,20-trihydroxyicosa-6,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 20-hydroxy-6-trans-LTB4 | ChEBI |
| (5S,12R,20)-trihydroxy-(6E,8E,10E,14Z)-icosatetraenoic acid | ChEBI |
| (5S,6E,8E,10E,12R,14Z)-5,12,20-trihydroxyicosatetraenoic acid | ChEBI |
| Citations |
|---|