EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | O=C(O)CCC/C=C\C/C=C\C=C\C(O)C/C=C\CCCCCO |
| InChI | InChI=1S/C20H32O4/c21-18-14-10-6-5-8-12-16-19(22)15-11-7-3-1-2-4-9-13-17-20(23)24/h2-4,7-8,11-12,15,19,21-22H,1,5-6,9-10,13-14,16-18H2,(H,23,24)/b4-2-,7-3-,12-8-,15-11+ |
| InChIKey | NUPDGIJXOAHJRW-LNESKJDXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (15364545) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12,20-DiHETE (CHEBI:90990) has functional parent (5Z,8Z,10E,14Z)-12-hydroxyicosatetraenoic acid (CHEBI:84447) |
| 12,20-DiHETE (CHEBI:90990) has role human xenobiotic metabolite (CHEBI:76967) |
| 12,20-DiHETE (CHEBI:90990) is a dihydroxyicosatetraenoic acid (CHEBI:72868) |
| 12,20-DiHETE (CHEBI:90990) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 12,20-DiHETE (CHEBI:90990) is conjugate acid of 12,20-DiHETE(1−) (CHEBI:90719) |
| Incoming Relation(s) |
| 12,20-DiHETE(1−) (CHEBI:90719) is conjugate base of 12,20-DiHETE (CHEBI:90990) |
| IUPAC Name |
|---|
| (5Z,8Z,10E,14Z)-12,20-dihydroxyicosa-5,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 12,20-dihydroxy-(5Z,8Z,10E,14Z)-icosatetraenoic acid | ChEBI |
| (5Z,8Z,10E,14Z)-12,20-dihydroxyicosatetraenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060105 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24406269 | Reaxys |
| Citations |
|---|