EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@]1([C@@](C)(O)CC[C@H](O)C(C)C)CC[C@@]2([H])/C(=C/C=C3/C[C@@H](O)CCC3=C)CCC[C@]12C |
| InChI | InChI=1S/C27H44O3/c1-18(2)24(29)14-16-27(5,30)25-13-12-23-20(7-6-15-26(23,25)4)9-10-21-17-22(28)11-8-19(21)3/h9-10,18,22-25,28-30H,3,6-8,11-17H2,1-2,4-5H3/b20-9+,21-10-/t22-,23-,24-,25-,26-,27-/m0/s1 |
| InChIKey | VKWNWFUXGYTMCJ-CQKDPTPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (11012668) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (20S,24S)-dihydroxyvitamin D3 (CHEBI:90986) has role human metabolite (CHEBI:77746) |
| (20S,24S)-dihydroxyvitamin D3 (CHEBI:90986) is a D3 vitamins (CHEBI:73558) |
| (20S,24S)-dihydroxyvitamin D3 (CHEBI:90986) is a hydroxycalciol (CHEBI:47042) |
| (20S,24S)-dihydroxyvitamin D3 (CHEBI:90986) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (3S,5Z,7E,24S)-9,10-secocholesta-5,7,10-triene-3,20,24-triol |
| Synonym | Source |
|---|---|
| 20S,24S(OH)2D3 | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 20S,24S-dihydroxycholecalciferol | UniProt |
| Citations |
|---|