EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O4 |
| Net Charge | 0 |
| Average Mass | 430.629 |
| Monoisotopic Mass | 430.30831 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)C[C@H](O)C(=O)C(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C27H42O4/c1-17-8-11-21(28)16-20(17)10-9-19-7-6-14-27(5)22(12-13-23(19)27)18(2)15-24(29)25(30)26(3,4)31/h9-10,18,21-24,28-29,31H,1,6-8,11-16H2,2-5H3/b19-9+,20-10-/t18-,21+,22-,23+,24+,27-/m1/s1 |
| InChIKey | LYVJVKJTSXESPC-JDHDJSQBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (11012668) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 23(S),25-dihydroxy-24-oxovitamin D3 (CHEBI:90980) has role human metabolite (CHEBI:77746) |
| 23(S),25-dihydroxy-24-oxovitamin D3 (CHEBI:90980) is a D3 vitamins (CHEBI:73558) |
| 23(S),25-dihydroxy-24-oxovitamin D3 (CHEBI:90980) is a hydroxycalciol (CHEBI:47042) |
| 23(S),25-dihydroxy-24-oxovitamin D3 (CHEBI:90980) is a oxocalciol (CHEBI:47806) |
| 23(S),25-dihydroxy-24-oxovitamin D3 (CHEBI:90980) is a secondary α-hydroxy ketone (CHEBI:2468) |
| 23(S),25-dihydroxy-24-oxovitamin D3 (CHEBI:90980) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| 23(S),25-dihydroxy-24-oxovitamin D3 (CHEBI:90980) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (3S,5Z,7E,23S)-3,23,25-trihydroxy-9,10-secocholesta-5,7,10-trien-24-one |
| Synonym | Source |
|---|---|
| 24-oxo-23S,25-(OH)2D3 | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 23S,25-dihydroxy-24-oxocholecalciferol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8812782 | Reaxys |
| Citations |
|---|