EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2Se |
| Net Charge | 0 |
| Average Mass | 182.081 |
| Monoisotopic Mass | 182.97985 |
| SMILES | N[C@@H](CC[SeH])C(=O)O |
| InChI | InChI=1S/C4H9NO2Se/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m0/s1 |
| InChIKey | RCWCGLALNCIQNM-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-selenohomocysteine (CHEBI:9096) has role mammalian metabolite (CHEBI:75768) |
| L-selenohomocysteine (CHEBI:9096) is a selenoamino acid (CHEBI:26629) |
| L-selenohomocysteine (CHEBI:9096) is tautomer of L-selenohomocysteine zwitterion (CHEBI:84850) |
| Incoming Relation(s) |
| L-selenohomocysteine zwitterion (CHEBI:84850) is tautomer of L-selenohomocysteine (CHEBI:9096) |
| Synonyms | Source |
|---|---|
| Selenohomocysteine | KEGG COMPOUND |
| seleno-L-homocysteine | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| C05698 | KEGG COMPOUND |
| SELENOHOMOCYSTEINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8761894 | Reaxys |
| Citations |
|---|