EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C19H22NO4S2 |
| Net Charge | 0 |
| Average Mass | 472.426 |
| Monoisotopic Mass | 471.01736 |
| SMILES | [Br-].[H][C@]12C[C@H](OC(=O)C(O)(c3cccs3)c3cccs3)C[C@]([H])([C@H]3O[C@H]31)[N+]2(C)C |
| InChI | InChI=1S/C19H22NO4S2.BrH/c1-20(2)12-9-11(10-13(20)17-16(12)24-17)23-18(21)19(22,14-5-3-7-25-14)15-6-4-8-26-15;/h3-8,11-13,16-17,22H,9-10H2,1-2H3;1H/q+1;/p-1/t11-,12-,13+,16-,17+; |
| InChIKey | DQHNAVOVODVIMG-FOGIBKMMSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiotropium bromide (CHEBI:90959) has role bronchodilator agent (CHEBI:35523) |
| tiotropium bromide (CHEBI:90959) has role muscarinic antagonist (CHEBI:48876) |
| tiotropium bromide (CHEBI:90959) is a organic bromide salt (CHEBI:48369) |
| tiotropium bromide (CHEBI:90959) is a quaternary ammonium salt (CHEBI:35273) |
| INN | Source |
|---|---|
| tiotropium bromide | ChemIDplus |
| Synonyms | Source |
|---|---|
| (1α,2β,4β,5α,7β)-7-[(hydroxydi-2-thienylacetyl)oxy]-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonane bromide | IUPAC |
| 7-((Hydroxybis(2-thienyl)acetyl)oxy)-9,9-dimethyl-3-oxa-9-azoniatricyclo(3.3.1.0(2,4))nonane bromide | ChemIDplus |
| BA 679 BR | ChemIDplus |
| BA 679BR | ChemIDplus |
| BA-679 BR | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Tiotropium_bromide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11069044 | Reaxys |
| CAS:136310-93-5 | ChemIDplus |
| Citations |
|---|