EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C19H22NO4S2 |
| Net Charge | 0 |
| Average Mass | 472.426 |
| Monoisotopic Mass | 471.01736 |
| SMILES | [Br-].[H][C@]12C[C@H](OC(=O)C(O)(c3cccs3)c3cccs3)C[C@]([H])([C@H]3O[C@H]31)[N+]2(C)C |
| InChI | InChI=1S/C19H22NO4S2.BrH/c1-20(2)12-9-11(10-13(20)17-16(12)24-17)23-18(21)19(22,14-5-3-7-25-14)15-6-4-8-26-15;/h3-8,11-13,16-17,22H,9-10H2,1-2H3;1H/q+1;/p-1/t11-,12-,13+,16-,17+; |
| InChIKey | DQHNAVOVODVIMG-FOGIBKMMSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiotropium bromide (CHEBI:90959) has role bronchodilator agent (CHEBI:35523) |
| tiotropium bromide (CHEBI:90959) has role muscarinic antagonist (CHEBI:48876) |
| tiotropium bromide (CHEBI:90959) is a organic bromide salt (CHEBI:48369) |
| tiotropium bromide (CHEBI:90959) is a quaternary ammonium salt (CHEBI:35273) |
| INN | Source |
|---|---|
| tiotropium bromide | ChemIDplus |
| Synonyms | Source |
|---|---|
| (1α,2β,4β,5α,7β)-7-[(hydroxydi-2-thienylacetyl)oxy]-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonane bromide | IUPAC |
| 7-((Hydroxybis(2-thienyl)acetyl)oxy)-9,9-dimethyl-3-oxa-9-azoniatricyclo(3.3.1.0(2,4))nonane bromide | ChemIDplus |
| BA 679 BR | ChemIDplus |
| BA 679BR | ChemIDplus |
| BA-679 BR | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Tiotropium_bromide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11069044 | Reaxys |
| CAS:136310-93-5 | ChemIDplus |
| Citations |
|---|