EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O2 |
| Net Charge | 0 |
| Average Mass | 170.252 |
| Monoisotopic Mass | 170.13068 |
| SMILES | CC(C)[C@@]12CC[C@@](C)(O1)[C@@H](O)C2 |
| InChI | InChI=1S/C10H18O2/c1-7(2)10-5-4-9(3,12-10)8(11)6-10/h7-8,11H,4-6H2,1-3H3/t8-,9+,10-/m0/s1 |
| InChIKey | IFQZADDJTDGGCP-AEJSXWLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (11695850) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (11695850) |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-exo-hydroxy-1,4-cineole (CHEBI:90956) has role human xenobiotic metabolite (CHEBI:76967) |
| 2-exo-hydroxy-1,4-cineole (CHEBI:90956) has role rat metabolite (CHEBI:86264) |
| 2-exo-hydroxy-1,4-cineole (CHEBI:90956) is a cineole (CHEBI:23243) |
| IUPAC Name |
|---|
| (1R,2S,4S)-1-methyl-4-(propan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-ol |
| UniProt Name | Source |
|---|---|
| 2-exo-hydroxy-1,4-cineole | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5241415 | Reaxys |
| Citations |
|---|