EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O |
| Net Charge | 0 |
| Average Mass | 304.393 |
| Monoisotopic Mass | 304.15756 |
| SMILES | CCC1C/C(=C\c2cccnc2)C(=O)/C(=C/c2cccnc2)C1 |
| InChI | InChI=1S/C20H20N2O/c1-2-15-9-18(11-16-5-3-7-21-13-16)20(23)19(10-15)12-17-6-4-8-22-14-17/h3-8,11-15H,2,9-10H2,1H3/b18-11+,19-12+ |
| InChIKey | MMBSCBVEHMETSA-GDAWTGGTSA-N |
| Roles Classification |
|---|
| Biological Role: | steroid receptor coactivator stimulator A compound that enhances the activity of a steroid receptor coactivator. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MCB-613 (CHEBI:90954) has role antineoplastic agent (CHEBI:35610) |
| MCB-613 (CHEBI:90954) has role steroid receptor coactivator stimulator (CHEBI:90991) |
| MCB-613 (CHEBI:90954) is a cyclic ketone (CHEBI:3992) |
| MCB-613 (CHEBI:90954) is a enone (CHEBI:51689) |
| MCB-613 (CHEBI:90954) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| (2E,6E)-4-ethyl-2,6-bis(pyridin-3-ylmethylene)cyclohexanone |
| Synonyms | Source |
|---|---|
| MCB613 | ChEBI |
| MCB 613 | ChEBI |
| (2E,6E)-4-ethyl-2,6-bis(3-pyridylmethylene)cyclohexan-1-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO2008144011 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25955891 | Reaxys |
| Citations |
|---|