EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C72H112O48S8 |
| Net Charge | 0 |
| Average Mass | 2002.176 |
| Monoisotopic Mass | 2000.40887 |
| SMILES | O=C(O)CCSC[C@H]1O[C@@H]2O[C@H]3[C@H](O)[C@@H](O)[C@@H](O[C@H]4[C@H](O)[C@@H](O)[C@@H](O[C@H]5[C@H](O)[C@@H](O)[C@@H](O[C@H]6[C@H](O)[C@@H](O)[C@@H](O[C@H]7[C@H](O)[C@@H](O)[C@@H](O[C@H]8[C@H](O)[C@@H](O)[C@@H](O[C@H]9[C@H](O)[C@@H](O)[C@@H](O[C@H]1[C@H](O)[C@H]2O)O[C@@H]9CSCCC(=O)O)O[C@@H]8CSCCC(=O)O)O[C@@H]7CSCCC(=O)O)O[C@@H]6CSCCC(=O)O)O[C@@H]5CSCCC(=O)O)O[C@@H]4CSCCC(=O)O)O[C@@H]3CSCCC(=O)O |
| InChI | InChI=1S/C72H112O48S8/c73-33(74)1-9-121-17-25-57-41(89)49(97)65(105-25)114-58-26(18-122-10-2-34(75)76)107-67(51(99)43(58)91)116-60-28(20-124-12-4-36(79)80)109-69(53(101)45(60)93)118-62-30(22-126-14-6-38(83)84)111-71(55(103)47(62)95)120-64-32(24-128-16-8-40(87)88)112-72(56(104)48(64)96)119-63-31(23-127-15-7-39(85)86)110-70(54(102)46(63)94)117-61-29(21-125-13-5-37(81)82)108-68(52(100)44(61)92)115-59-27(19-123-11-3-35(77)78)106-66(113-57)50(98)42(59)90/h25-32,41-72,89-104H,1-24H2,(H,73,74)(H,75,76)(H,77,78)(H,79,80)(H,81,82)(H,83,84)(H,85,86)(H,87,88)/t25-,26-,27-,28-,29-,30-,31-,32-,41-,42-,43-,44-,45-,46-,47-,48-,49-,50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71-,72-/m1/s1 |
| InChIKey | WHRODDIHRRDWEW-VTHZAVIASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuromuscular agent A drug used for its actions on skeletal muscle. renoprotective agent Any compound that is able to prevent damage to the kidneys. antidote to organophosphate poisoning A role borne by a molecule that acts to counteract or neutralise the deleterious effects of organophosphates or acetylcholinesterase inhibitors (nerve agents). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sugammadex (CHEBI:90953) has functional parent γ-cyclodextrin (CHEBI:495056) |
| sugammadex (CHEBI:90953) has role anti-obesity agent (CHEBI:74518) |
| sugammadex (CHEBI:90953) has role antidote to organophosphate poisoning (CHEBI:90753) |
| sugammadex (CHEBI:90953) has role antineoplastic agent (CHEBI:35610) |
| sugammadex (CHEBI:90953) has role neuromuscular agent (CHEBI:51372) |
| sugammadex (CHEBI:90953) has role renoprotective agent (CHEBI:231911) |
| sugammadex (CHEBI:90953) is a octasaccharide derivative (CHEBI:71061) |
| sugammadex (CHEBI:90953) is a organic sulfide (CHEBI:16385) |
| sugammadex (CHEBI:90953) is conjugate acid of sugammadex(8−) (CHEBI:90957) |
| Incoming Relation(s) |
| sugammadex(8−) (CHEBI:90957) is conjugate base of sugammadex (CHEBI:90953) |
| INN | Source |
|---|---|
| sugammadex | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4233 | DrugCentral |
| Sugammadex | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:343306-71-8 | ChemIDplus |
| Citations |
|---|